C35H29O2P — CID 175427316
(E)-2-[[2-(2-diphenylphosphanyl-4-methylphenyl)phenyl]methyl]-3-phenylprop-2-enoic acid (PubChem CID 175427316) has the molecular formula C35H29O2P and a molecular weight of 512.59 g/mol. Its IUPAC name is (E)-2-[[2-(2-diphenylphosphanyl-4-methylphenyl)phenyl]methyl]-3-phenylprop-2-enoic acid.
| Compound Name | (E)-2-[[2-(2-diphenylphosphanyl-4-methylphenyl)phenyl]methyl]-3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 175427316 |
| Molecular Formula | C35H29O2P |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (E)-2-[[2-(2-diphenylphosphanyl-4-methylphenyl)phenyl]methyl]-3-phenylprop-2-enoic acid |
| SMILES | Cc1ccc(-c2ccccc2C/C(=C\c2ccccc2)C(=O)O)c(P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H29O2P/c1-26-21-22-33(34(23-26)38(30-16-7-3-8-17-30)31-18-9-4-10-19-31)32-20-12-11-15-28(32)25-29(35(36)37)24-27-13-5-2-6-14-27/h2-24H,25H2,1H3,(H,36,37)/b29-24+ |
| InChIKey | SGQYHROFUSDVIB-RMLRFSFXSA-N |
| XLogP | 7.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|