C35H28FO3P — CID 175247603
(E)-2-[[2-(2-diphenylphosphanylphenyl)phenyl]methyl]-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid (PubChem CID 175247603) has the molecular formula C35H28FO3P and a molecular weight of 546.58 g/mol. Its IUPAC name is (E)-2-[[2-(2-diphenylphosphanylphenyl)phenyl]methyl]-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[[2-(2-diphenylphosphanylphenyl)phenyl]methyl]-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 175247603 |
| Molecular Formula | C35H28FO3P |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (E)-2-[[2-(2-diphenylphosphanylphenyl)phenyl]methyl]-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(\Cc2ccccc2-c2ccccc2P(c2ccccc2)c2ccccc2)C(=O)O)cc1F |
| InChI | InChI=1S/C35H28FO3P/c1-39-33-21-20-25(23-32(33)36)22-27(35(37)38)24-26-12-8-9-17-30(26)31-18-10-11-19-34(31)40(28-13-4-2-5-14-28)29-15-6-3-7-16-29/h2-23H,24H2,1H3,(H,37,38)/b27-22+ |
| InChIKey | YKTNWXZLBAUIAN-HPNDGRJYSA-N |
| XLogP | 6.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|