C23H16ClF2N5O — CID 175427748
6-(4-chlorophenyl)-2-(2-fluoro-4-pyridinyl)-N-[1-(2-fluoro-4-pyridinyl)ethyl]pyrimidine-4-carboxamide (PubChem CID 175427748) has the molecular formula C23H16ClF2N5O and a molecular weight of 451.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-(2-fluoro-4-pyridinyl)-N-[1-(2-fluoro-4-pyridinyl)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-2-(2-fluoro-4-pyridinyl)-N-[1-(2-fluoro-4-pyridinyl)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 175427748 |
| Molecular Formula | C23H16ClF2N5O |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 6-(4-chlorophenyl)-2-(2-fluoro-4-pyridinyl)-N-[1-(2-fluoro-4-pyridinyl)ethyl]pyrimidine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc(Cl)cc2)nc(-c2ccnc(F)c2)n1)c1ccnc(F)c1 |
| InChI | InChI=1S/C23H16ClF2N5O/c1-13(15-6-8-27-20(25)10-15)29-23(32)19-12-18(14-2-4-17(24)5-3-14)30-22(31-19)16-7-9-28-21(26)11-16/h2-13H,1H3,(H,29,32) |
| InChIKey | KDUSILBZUCYFSP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|