C19H14ClN3O4PS+ — CID 175428335
[6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanylmethoxy-hydroxy-oxophosphanium (PubChem CID 175428335) has the molecular formula C19H14ClN3O4PS+ and a molecular weight of 446.83 g/mol. Its IUPAC name is [6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanylmethoxy-hydroxy-oxophosphanium.
| Compound Name | [6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanylmethoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 175428335 |
| Molecular Formula | C19H14ClN3O4PS+ |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | [6-chloro-5-[4-(2-hydroxyphenyl)phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanylmethoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCSc1nc2nc(-c3ccc(-c4ccccc4O)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H13ClN3O4PS/c20-14-9-15-18(23-19(21-15)29-10-27-28(25)26)22-17(14)12-7-5-11(6-8-12)13-3-1-2-4-16(13)24/h1-9H,10H2,(H2-,21,22,23,24,25,26)/p+1 |
| InChIKey | BWTLUDHOCJHOEJ-UHFFFAOYSA-O |
| XLogP | 5.37 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|