C28H32N4O5 — CID 175428519
2-tert-butyl-1-[2-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]indazol-5-yl]azetidine-3-carboxylic acid (PubChem CID 175428519) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 2-tert-butyl-1-[2-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]indazol-5-yl]azetidine-3-carboxylic acid.
| Compound Name | 2-tert-butyl-1-[2-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]indazol-5-yl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 175428519 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 2-tert-butyl-1-[2-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]indazol-5-yl]azetidine-3-carboxylic acid |
| SMILES | COc1ccc(CN2C(=O)CCC(n3cc4cc(N5CC(C(=O)O)C5C(C)(C)C)ccc4n3)C2=O)cc1 |
| InChI | InChI=1S/C28H32N4O5/c1-28(2,3)25-21(27(35)36)16-30(25)19-7-10-22-18(13-19)15-32(29-22)23-11-12-24(33)31(26(23)34)14-17-5-8-20(37-4)9-6-17/h5-10,13,15,21,23,25H,11-12,14,16H2,1-4H3,(H,35,36) |
| InChIKey | AMBJRIGMAXIISS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|