About dimethyl(oxan-2-yl)silane;dioxotitanium
dimethyl(oxan-2-yl)silane;dioxotitanium (PubChem CID 175428634) has the molecular formula C7H16O3SiTi
and a molecular weight of 224.15 g/mol. Its IUPAC name is dimethyl(oxan-2-yl)silane;dioxotitanium.
Molecular Properties
| Compound Name | dimethyl(oxan-2-yl)silane;dioxotitanium |
| PubChem CID | 175428634 |
| Molecular Formula | C7H16O3SiTi |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | dimethyl(oxan-2-yl)silane;dioxotitanium |
| SMILES | C[SiH](C)C1CCCCO1.O=[Ti]=O |
| InChI | InChI=1S/C7H16OSi.2O.Ti/c1-9(2)7-5-3-4-6-8-7;;;/h7,9H,3-6H2,1-2H3;;; |
| InChIKey | UQVREQCGQKESKG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(oxan-2-yl)silane;dioxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(oxan-2-yl)silane;dioxotitanium?
The IUPAC name of dimethyl(oxan-2-yl)silane;dioxotitanium (CID 175428634) is dimethyl(oxan-2-yl)silane;dioxotitanium.
What is the SMILES notation for dimethyl(oxan-2-yl)silane;dioxotitanium?
The canonical SMILES for dimethyl(oxan-2-yl)silane;dioxotitanium is C[SiH](C)C1CCCCO1.O=[Ti]=O.
What is the InChIKey of dimethyl(oxan-2-yl)silane;dioxotitanium?
The InChIKey is UQVREQCGQKESKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OSi.2O.Ti/c1-9(2)7-5-3-4-6-8-7;;;/h7,9H,3-6H2,1-2H3;;;.
What are the key properties of dimethyl(oxan-2-yl)silane;dioxotitanium?
dimethyl(oxan-2-yl)silane;dioxotitanium has a molecular weight of 224.15 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(oxan-2-yl)silane;dioxotitanium is sourced from PubChem (CID 175428634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).