C45H88N2O5 — CID 175429890
4-[2-(2-aminoethoxy)ethoxy]-2-[(Z)-octadec-9-enoxy]-2-[[(Z)-octadec-9-enoxy]methyl]butanamide (PubChem CID 175429890) has the molecular formula C45H88N2O5 and a molecular weight of 737.21 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-2-[(Z)-octadec-9-enoxy]-2-[[(Z)-octadec-9-enoxy]methyl]butanamide.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-2-[(Z)-octadec-9-enoxy]-2-[[(Z)-octadec-9-enoxy]methyl]butanamide |
|---|---|
| PubChem CID | 175429890 |
| Molecular Formula | C45H88N2O5 |
| Molecular Weight | 737.21 g/mol |
| Exact Mass | 736.67 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-2-[(Z)-octadec-9-enoxy]-2-[[(Z)-octadec-9-enoxy]methyl]butanamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(CCOCCOCCN)(OCCCCCCCC/C=C\CCCCCCCC)C(N)=O |
| InChI | InChI=1S/C45H88N2O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-51-43-45(44(47)48,35-39-49-41-42-50-40-36-46)52-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-43,46H2,1-2H3,(H2,47,48)/b19-17-,20-18- |
| InChIKey | LOCNQKBWGZNJER-CLFAGFIQSA-N |
| XLogP | 11.70 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.21 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|