About octan-2-yl N,N-diethylcarbamate
octan-2-yl N,N-diethylcarbamate (PubChem CID 175430238) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is octan-2-yl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | octan-2-yl N,N-diethylcarbamate |
| PubChem CID | 175430238 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | octan-2-yl N,N-diethylcarbamate |
| SMILES | CCCCCCC(C)OC(=O)N(CC)CC |
| InChI | InChI=1S/C13H27NO2/c1-5-8-9-10-11-12(4)16-13(15)14(6-2)7-3/h12H,5-11H2,1-4H3 |
| InChIKey | RAQHZBQPHSOCJP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl N,N-diethylcarbamate?
The IUPAC name of octan-2-yl N,N-diethylcarbamate (CID 175430238) is octan-2-yl N,N-diethylcarbamate.
What is the SMILES notation for octan-2-yl N,N-diethylcarbamate?
The canonical SMILES for octan-2-yl N,N-diethylcarbamate is CCCCCCC(C)OC(=O)N(CC)CC.
What is the InChIKey of octan-2-yl N,N-diethylcarbamate?
The InChIKey is RAQHZBQPHSOCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-5-8-9-10-11-12(4)16-13(15)14(6-2)7-3/h12H,5-11H2,1-4H3.
What are the key properties of octan-2-yl N,N-diethylcarbamate?
octan-2-yl N,N-diethylcarbamate has a molecular weight of 229.36 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl N,N-diethylcarbamate is sourced from PubChem (CID 175430238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).