C18H20O5 — CID 175431857
methyl 3,4-dihydroxy-6-[2-(4-methoxyphenyl)ethyl]-2-methylbenzoate (PubChem CID 175431857) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-6-[2-(4-methoxyphenyl)ethyl]-2-methylbenzoate.
| Compound Name | methyl 3,4-dihydroxy-6-[2-(4-methoxyphenyl)ethyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 175431857 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl 3,4-dihydroxy-6-[2-(4-methoxyphenyl)ethyl]-2-methylbenzoate |
| SMILES | COC(=O)c1c(CCc2ccc(OC)cc2)cc(O)c(O)c1C |
| InChI | InChI=1S/C18H20O5/c1-11-16(18(21)23-3)13(10-15(19)17(11)20)7-4-12-5-8-14(22-2)9-6-12/h5-6,8-10,19-20H,4,7H2,1-3H3 |
| InChIKey | WNOJUZPTJVVPCX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|