C16H18O5 — CID 91551566
methyl 3-(hydroxymethyl)-5-[2-(4-methoxyphenyl)ethyl]furan-2-carboxylate (PubChem CID 91551566) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 3-(hydroxymethyl)-5-[2-(4-methoxyphenyl)ethyl]furan-2-carboxylate.
| Compound Name | methyl 3-(hydroxymethyl)-5-[2-(4-methoxyphenyl)ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 91551566 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | methyl 3-(hydroxymethyl)-5-[2-(4-methoxyphenyl)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1oc(CCc2ccc(OC)cc2)cc1CO |
| InChI | InChI=1S/C16H18O5/c1-19-13-6-3-11(4-7-13)5-8-14-9-12(10-17)15(21-14)16(18)20-2/h3-4,6-7,9,17H,5,8,10H2,1-2H3 |
| InChIKey | PDDLSGMDZOGPJZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |