C12H20N2O5S — CID 175432166
4,4-dimethyl-5-[4-(methylsulfonyloxymethyl)pyrazol-1-yl]pentanoic acid (PubChem CID 175432166) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4,4-dimethyl-5-[4-(methylsulfonyloxymethyl)pyrazol-1-yl]pentanoic acid.
| Compound Name | 4,4-dimethyl-5-[4-(methylsulfonyloxymethyl)pyrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 175432166 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4,4-dimethyl-5-[4-(methylsulfonyloxymethyl)pyrazol-1-yl]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)Cn1cc(COS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C12H20N2O5S/c1-12(2,5-4-11(15)16)9-14-7-10(6-13-14)8-19-20(3,17)18/h6-7H,4-5,8-9H2,1-3H3,(H,15,16) |
| InChIKey | GZSUDHHHZPEKDS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|