About benzo[a]anthracen-7-yl hypobromite
benzo[a]anthracen-7-yl hypobromite (PubChem CID 175436074) has the molecular formula C18H11BrO
and a molecular weight of 323.19 g/mol. Its IUPAC name is benzo[a]anthracen-7-yl hypobromite.
Molecular Properties
| Compound Name | benzo[a]anthracen-7-yl hypobromite |
| PubChem CID | 175436074 |
| Molecular Formula | C18H11BrO |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | benzo[a]anthracen-7-yl hypobromite |
| SMILES | BrOc1c2ccccc2cc2c1ccc1ccccc12 |
| InChI | InChI=1S/C18H11BrO/c19-20-18-15-8-4-2-6-13(15)11-17-14-7-3-1-5-12(14)9-10-16(17)18/h1-11H |
| InChIKey | LWMZWVJUNOABHJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[a]anthracen-7-yl hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]anthracen-7-yl hypobromite?
The IUPAC name of benzo[a]anthracen-7-yl hypobromite (CID 175436074) is benzo[a]anthracen-7-yl hypobromite.
What is the SMILES notation for benzo[a]anthracen-7-yl hypobromite?
The canonical SMILES for benzo[a]anthracen-7-yl hypobromite is BrOc1c2ccccc2cc2c1ccc1ccccc12.
What is the InChIKey of benzo[a]anthracen-7-yl hypobromite?
The InChIKey is LWMZWVJUNOABHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrO/c19-20-18-15-8-4-2-6-13(15)11-17-14-7-3-1-5-12(14)9-10-16(17)18/h1-11H.
What are the key properties of benzo[a]anthracen-7-yl hypobromite?
benzo[a]anthracen-7-yl hypobromite has a molecular weight of 323.19 g/mol, XLogP of 5.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]anthracen-7-yl hypobromite is sourced from PubChem (CID 175436074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).