C9H16F4I2 — CID 175436112
1,1-difluoro-1-iodo-2-methylpropane;1,1-difluoro-1-iodopentane (PubChem CID 175436112) has the molecular formula C9H16F4I2 and a molecular weight of 454.03 g/mol. Its IUPAC name is 1,1-difluoro-1-iodo-2-methylpropane;1,1-difluoro-1-iodopentane.
| Compound Name | 1,1-difluoro-1-iodo-2-methylpropane;1,1-difluoro-1-iodopentane |
|---|---|
| PubChem CID | 175436112 |
| Molecular Formula | C9H16F4I2 |
| Molecular Weight | 454.03 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | 1,1-difluoro-1-iodo-2-methylpropane;1,1-difluoro-1-iodopentane |
| SMILES | CC(C)C(F)(F)I.CCCCC(F)(F)I |
| InChI | InChI=1S/C5H9F2I.C4H7F2I/c1-2-3-4-5(6,7)8;1-3(2)4(5,6)7/h2-4H2,1H3;3H,1-2H3 |
| InChIKey | MOLRTUQHRVEKEO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.03 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|