C12H19F5I2 — CID 126547472
1,1-difluoro-1-iodo-5-(2-iodoethyl)-5-(trifluoromethyl)nonane (PubChem CID 126547472) has the molecular formula C12H19F5I2 and a molecular weight of 512.08 g/mol. Its IUPAC name is 1,1-difluoro-1-iodo-5-(2-iodoethyl)-5-(trifluoromethyl)nonane.
| Compound Name | 1,1-difluoro-1-iodo-5-(2-iodoethyl)-5-(trifluoromethyl)nonane |
|---|---|
| PubChem CID | 126547472 |
| Molecular Formula | C12H19F5I2 |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | 1,1-difluoro-1-iodo-5-(2-iodoethyl)-5-(trifluoromethyl)nonane |
| SMILES | CCCCC(CCI)(CCCC(F)(F)I)C(F)(F)F |
| InChI | InChI=1S/C12H19F5I2/c1-2-3-5-10(8-9-18,12(15,16)17)6-4-7-11(13,14)19/h2-9H2,1H3 |
| InChIKey | ZKYVJYHAYWMORD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|