C24H28N6O3S — CID 175437029
N-[5-(1-morpholin-2-yl-2-oxoethyl)-2-piperidin-1-ylphenyl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 175437029) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[5-(1-morpholin-2-yl-2-oxoethyl)-2-piperidin-1-ylphenyl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-(1-morpholin-2-yl-2-oxoethyl)-2-piperidin-1-ylphenyl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 175437029 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-[5-(1-morpholin-2-yl-2-oxoethyl)-2-piperidin-1-ylphenyl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=CC(c1ccc(N2CCCCC2)c(NC(=O)c2csc(-c3cn[nH]c3)n2)c1)C1CNCCO1 |
| InChI | InChI=1S/C24H28N6O3S/c31-14-18(22-13-25-6-9-33-22)16-4-5-21(30-7-2-1-3-8-30)19(10-16)28-23(32)20-15-34-24(29-20)17-11-26-27-12-17/h4-5,10-12,14-15,18,22,25H,1-3,6-9,13H2,(H,26,27)(H,28,32) |
| InChIKey | XHNOUMNPICPWNH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|