C18H17N5O3S — CID 166778803
N-(2-formyl-5-morpholin-4-ylphenyl)-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 166778803) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is N-(2-formyl-5-morpholin-4-ylphenyl)-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-formyl-5-morpholin-4-ylphenyl)-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166778803 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-(2-formyl-5-morpholin-4-ylphenyl)-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=Cc1ccc(N2CCOCC2)cc1NC(=O)c1csc(-c2cn[nH]c2)n1 |
| InChI | InChI=1S/C18H17N5O3S/c24-10-12-1-2-14(23-3-5-26-6-4-23)7-15(12)21-17(25)16-11-27-18(22-16)13-8-19-20-9-13/h1-2,7-11H,3-6H2,(H,19,20)(H,21,25) |
| InChIKey | XQCYZJZRBKVULP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|