C14H16N4O2S — CID 67450045
2-(4-morpholin-4-ylphenyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 67450045) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylphenyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(4-morpholin-4-ylphenyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 67450045 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-(4-morpholin-4-ylphenyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | NNC(=O)c1csc(-c2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C14H16N4O2S/c15-17-13(19)12-9-21-14(16-12)10-1-3-11(4-2-10)18-5-7-20-8-6-18/h1-4,9H,5-8,15H2,(H,17,19) |
| InChIKey | ZSHBGXXOLJOUTE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|