C18H8N4 — CID 175438792
naphtho[2,3-f]quinoxaline-2,3-dicarbonitrile (PubChem CID 175438792) has the molecular formula C18H8N4 and a molecular weight of 280.29 g/mol. Its IUPAC name is naphtho[2,3-f]quinoxaline-2,3-dicarbonitrile.
| Compound Name | naphtho[2,3-f]quinoxaline-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 175438792 |
| Molecular Formula | C18H8N4 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | naphtho[2,3-f]quinoxaline-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2ccc3cc4ccccc4cc3c2nc1C#N |
| InChI | InChI=1S/C18H8N4/c19-9-16-17(10-20)22-18-14-8-12-4-2-1-3-11(12)7-13(14)5-6-15(18)21-16/h1-8H |
| InChIKey | UDRHWZNMWJRMBJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|