C14H6N4O — CID 137082941
6-hydroxybenzo[f]quinoxaline-2,3-dicarbonitrile (PubChem CID 137082941) has the molecular formula C14H6N4O and a molecular weight of 246.23 g/mol. Its IUPAC name is 6-hydroxybenzo[f]quinoxaline-2,3-dicarbonitrile.
| Compound Name | 6-hydroxybenzo[f]quinoxaline-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 137082941 |
| Molecular Formula | C14H6N4O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 6-hydroxybenzo[f]quinoxaline-2,3-dicarbonitrile |
| SMILES | N#Cc1nc2cc(O)c3ccccc3c2nc1C#N |
| InChI | InChI=1S/C14H6N4O/c15-6-11-12(7-16)18-14-9-4-2-1-3-8(9)13(19)5-10(14)17-11/h1-5,19H |
| InChIKey | RBICAAUAHPQUHS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|