C8H17F3N2O6S2 — CID 175439279
1-piperazin-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 175439279) has the molecular formula C8H17F3N2O6S2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-piperazin-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid.
| Compound Name | 1-piperazin-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175439279 |
| Molecular Formula | C8H17F3N2O6S2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 1-piperazin-1-ylpropane-1-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | CCC(N1CCNCC1)S(=O)(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C7H16N2O3S.CHF3O3S/c1-2-7(13(10,11)12)9-5-3-8-4-6-9;2-1(3,4)8(5,6)7/h7-8H,2-6H2,1H3,(H,10,11,12);(H,5,6,7) |
| InChIKey | MCHJHKTYCOTLKR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|