C12H26N2O4S — CID 175177937
3-ethyl-5-hydroxy-1-piperazin-1-ylhexane-1-sulfonic acid (PubChem CID 175177937) has the molecular formula C12H26N2O4S and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-ethyl-5-hydroxy-1-piperazin-1-ylhexane-1-sulfonic acid.
| Compound Name | 3-ethyl-5-hydroxy-1-piperazin-1-ylhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 175177937 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-ethyl-5-hydroxy-1-piperazin-1-ylhexane-1-sulfonic acid |
| SMILES | CCC(CC(C)O)CC(N1CCNCC1)S(=O)(=O)O |
| InChI | InChI=1S/C12H26N2O4S/c1-3-11(8-10(2)15)9-12(19(16,17)18)14-6-4-13-5-7-14/h10-13,15H,3-9H2,1-2H3,(H,16,17,18) |
| InChIKey | XOIYPLKSDQLMJL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|