About 5-iodohept-2-yn-4-yl carbamate
5-iodohept-2-yn-4-yl carbamate (PubChem CID 175439603) has the molecular formula C8H12INO2
and a molecular weight of 281.09 g/mol. Its IUPAC name is 5-iodohept-2-yn-4-yl carbamate.
Molecular Properties
| Compound Name | 5-iodohept-2-yn-4-yl carbamate |
| PubChem CID | 175439603 |
| Molecular Formula | C8H12INO2 |
| Molecular Weight | 281.09 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 5-iodohept-2-yn-4-yl carbamate |
| SMILES | CC#CC(OC(N)=O)C(I)CC |
| InChI | InChI=1S/C8H12INO2/c1-3-5-7(6(9)4-2)12-8(10)11/h6-7H,4H2,1-2H3,(H2,10,11) |
| InChIKey | JIMJPBBUSIFHFV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.09 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-iodohept-2-yn-4-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodohept-2-yn-4-yl carbamate?
The IUPAC name of 5-iodohept-2-yn-4-yl carbamate (CID 175439603) is 5-iodohept-2-yn-4-yl carbamate.
What is the SMILES notation for 5-iodohept-2-yn-4-yl carbamate?
The canonical SMILES for 5-iodohept-2-yn-4-yl carbamate is CC#CC(OC(N)=O)C(I)CC.
What is the InChIKey of 5-iodohept-2-yn-4-yl carbamate?
The InChIKey is JIMJPBBUSIFHFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12INO2/c1-3-5-7(6(9)4-2)12-8(10)11/h6-7H,4H2,1-2H3,(H2,10,11).
What are the key properties of 5-iodohept-2-yn-4-yl carbamate?
5-iodohept-2-yn-4-yl carbamate has a molecular weight of 281.09 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodohept-2-yn-4-yl carbamate is sourced from PubChem (CID 175439603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).