About carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine
carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine (PubChem CID 174443718) has the molecular formula C11H22IN3O4
and a molecular weight of 387.22 g/mol. Its IUPAC name is carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine.
Molecular Properties
| Compound Name | carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine |
| PubChem CID | 174443718 |
| Molecular Formula | C11H22IN3O4 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine |
| SMILES | CC#CC(CN)C(I)CCC.NC(=O)O.NC(=O)O |
| InChI | InChI=1S/C9H16IN.2CH3NO2/c1-3-5-8(7-11)9(10)6-4-2;2*2-1(3)4/h8-9H,4,6-7,11H2,1-2H3;2*2H2,(H,3,4) |
| InChIKey | ADZJGXMOLYQEPP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine?
The IUPAC name of carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine (CID 174443718) is carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine.
What is the SMILES notation for carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine?
The canonical SMILES for carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine is CC#CC(CN)C(I)CCC.NC(=O)O.NC(=O)O.
What is the InChIKey of carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine?
The InChIKey is ADZJGXMOLYQEPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16IN.2CH3NO2/c1-3-5-8(7-11)9(10)6-4-2;2*2-1(3)4/h8-9H,4,6-7,11H2,1-2H3;2*2H2,(H,3,4).
What are the key properties of carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine?
carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine has a molecular weight of 387.22 g/mol, XLogP of 1.43, 4 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;3-iodo-2-prop-1-ynylhexan-1-amine is sourced from PubChem (CID 174443718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).