About 2-aminoacetic acid;4-methylheptane
2-aminoacetic acid;4-methylheptane (PubChem CID 143106228) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-aminoacetic acid;4-methylheptane.
Molecular Properties
| Compound Name | 2-aminoacetic acid;4-methylheptane |
| PubChem CID | 143106228 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 2-aminoacetic acid;4-methylheptane |
| SMILES | CCCC(C)CCC.NCC(=O)O |
| InChI | InChI=1S/C8H18.C2H5NO2/c1-4-6-8(3)7-5-2;3-1-2(4)5/h8H,4-7H2,1-3H3;1,3H2,(H,4,5) |
| InChIKey | RPYHGOXGAZSTFT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminoacetic acid;4-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;4-methylheptane?
The IUPAC name of 2-aminoacetic acid;4-methylheptane (CID 143106228) is 2-aminoacetic acid;4-methylheptane.
What is the SMILES notation for 2-aminoacetic acid;4-methylheptane?
The canonical SMILES for 2-aminoacetic acid;4-methylheptane is CCCC(C)CCC.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;4-methylheptane?
The InChIKey is RPYHGOXGAZSTFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C2H5NO2/c1-4-6-8(3)7-5-2;3-1-2(4)5/h8H,4-7H2,1-3H3;1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;4-methylheptane?
2-aminoacetic acid;4-methylheptane has a molecular weight of 189.30 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;4-methylheptane is sourced from PubChem (CID 143106228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).