About bis(2-aminoacetic acid);butanoic acid
bis(2-aminoacetic acid);butanoic acid (PubChem CID 174823541) has the molecular formula C8H18N2O6
and a molecular weight of 238.24 g/mol. Its IUPAC name is bis(2-aminoacetic acid);butanoic acid.
Molecular Properties
| Compound Name | bis(2-aminoacetic acid);butanoic acid |
| PubChem CID | 174823541 |
| Molecular Formula | C8H18N2O6 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | bis(2-aminoacetic acid);butanoic acid |
| SMILES | CCCC(=O)O.NCC(=O)O.NCC(=O)O |
| InChI | InChI=1S/C4H8O2.2C2H5NO2/c1-2-3-4(5)6;2*3-1-2(4)5/h2-3H2,1H3,(H,5,6);2*1,3H2,(H,4,5) |
| InChIKey | KHERUUZYYHAGJP-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-aminoacetic acid);butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminoacetic acid);butanoic acid?
The IUPAC name of bis(2-aminoacetic acid);butanoic acid (CID 174823541) is bis(2-aminoacetic acid);butanoic acid.
What is the SMILES notation for bis(2-aminoacetic acid);butanoic acid?
The canonical SMILES for bis(2-aminoacetic acid);butanoic acid is CCCC(=O)O.NCC(=O)O.NCC(=O)O.
What is the InChIKey of bis(2-aminoacetic acid);butanoic acid?
The InChIKey is KHERUUZYYHAGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.2C2H5NO2/c1-2-3-4(5)6;2*3-1-2(4)5/h2-3H2,1H3,(H,5,6);2*1,3H2,(H,4,5).
What are the key properties of bis(2-aminoacetic acid);butanoic acid?
bis(2-aminoacetic acid);butanoic acid has a molecular weight of 238.24 g/mol, XLogP of -1.07, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminoacetic acid);butanoic acid is sourced from PubChem (CID 174823541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).