C23H14Cl2O5 — CID 175439695
2,7-dichloro-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene;(4-oxo-3-phenylchromen-7-yl) acetate (PubChem CID 175439695) has the molecular formula C23H14Cl2O5 and a molecular weight of 441.27 g/mol. Its IUPAC name is 2,7-dichloro-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene;(4-oxo-3-phenylchromen-7-yl) acetate.
| Compound Name | 2,7-dichloro-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene;(4-oxo-3-phenylchromen-7-yl) acetate |
|---|---|
| PubChem CID | 175439695 |
| Molecular Formula | C23H14Cl2O5 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2,7-dichloro-6-oxabicyclo[3.1.1]hepta-1,3,5(7)-triene;(4-oxo-3-phenylchromen-7-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(=O)c(-c3ccccc3)coc2c1.Clc1ccc2c(Cl)c1O2 |
| InChI | InChI=1S/C17H12O4.C6H2Cl2O/c1-11(18)21-13-7-8-14-16(9-13)20-10-15(17(14)19)12-5-3-2-4-6-12;7-3-1-2-4-5(8)6(3)9-4/h2-10H,1H3;1-2H |
| InChIKey | XTOOHNBXTPVCQD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|