C30H25F6N7O4S — CID 175440066
1-[3-[5-methyl-2-(1,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]urea (PubChem CID 175440066) has the molecular formula C30H25F6N7O4S and a molecular weight of 693.63 g/mol. Its IUPAC name is 1-[3-[5-methyl-2-(1,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]urea.
| Compound Name | 1-[3-[5-methyl-2-(1,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]urea |
|---|---|
| PubChem CID | 175440066 |
| Molecular Formula | C30H25F6N7O4S |
| Molecular Weight | 693.63 g/mol |
| Exact Mass | 693.16 |
| IUPAC Name | 1-[3-[5-methyl-2-(1,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethylamino]urea |
| SMILES | Cc1ccc(OC(F)C(F)F)c(N2C(=O)CSC2=NC(=O)NNC(C)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C30H25F6N7O4S/c1-16-3-12-23(46-26(33)25(31)32)22(13-16)43-24(44)14-48-29(43)38-28(45)40-39-17(2)18-4-6-19(7-5-18)27-37-15-42(41-27)20-8-10-21(11-9-20)47-30(34,35)36/h3-13,15,17,25-26,39H,14H2,1-2H3,(H,40,45) |
| InChIKey | JIXAGTQOQXVMFP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|