C15H23NOS — CID 175444020
tert-butyl-[1-(2,3-dihydro-1H-inden-5-yl)ethylamino]-oxidosulfanium (PubChem CID 175444020) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is tert-butyl-[1-(2,3-dihydro-1H-inden-5-yl)ethylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-(2,3-dihydro-1H-inden-5-yl)ethylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175444020 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | tert-butyl-[1-(2,3-dihydro-1H-inden-5-yl)ethylamino]-oxidosulfanium |
| SMILES | CC(N[S+]([O-])C(C)(C)C)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H23NOS/c1-11(16-18(17)15(2,3)4)13-9-8-12-6-5-7-14(12)10-13/h8-11,16H,5-7H2,1-4H3 |
| InChIKey | WWOPOBAQJZOUMN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|