C16H11N4O2+ — CID 175446073
N-[4-(4-cyanophenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-carboxamide (PubChem CID 175446073) has the molecular formula C16H11N4O2+ and a molecular weight of 291.29 g/mol. Its IUPAC name is N-[4-(4-cyanophenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-carboxamide.
| Compound Name | N-[4-(4-cyanophenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 175446073 |
| Molecular Formula | C16H11N4O2+ |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[4-(4-cyanophenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-carboxamide |
| SMILES | N#Cc1ccc(-c2coc(NC(=O)[n+]3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H10N4O2/c17-10-12-4-6-13(7-5-12)14-11-22-15(18-14)19-16(21)20-8-2-1-3-9-20/h1-9,11H/p+1 |
| InChIKey | VQWFXPACMMLPAR-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|