C16H17N3O — CID 175446263
N-[1-(8-methyl-9H-pyrido[3,4-b]indol-1-yl)ethyl]acetamide (PubChem CID 175446263) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[1-(8-methyl-9H-pyrido[3,4-b]indol-1-yl)ethyl]acetamide.
| Compound Name | N-[1-(8-methyl-9H-pyrido[3,4-b]indol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 175446263 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-[1-(8-methyl-9H-pyrido[3,4-b]indol-1-yl)ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1nccc2c1[nH]c1c(C)cccc12 |
| InChI | InChI=1S/C16H17N3O/c1-9-5-4-6-12-13-7-8-17-15(10(2)18-11(3)20)16(13)19-14(9)12/h4-8,10,19H,1-3H3,(H,18,20) |
| InChIKey | QVXATAJRXKOSFE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |