C34H27NO5 — CID 175448183
(E)-3-[4-[3-(2-ethylbenzoyl)-7-phenylmethoxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 175448183) has the molecular formula C34H27NO5 and a molecular weight of 529.59 g/mol. Its IUPAC name is (E)-3-[4-[3-(2-ethylbenzoyl)-7-phenylmethoxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-(2-ethylbenzoyl)-7-phenylmethoxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175448183 |
| Molecular Formula | C34H27NO5 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | (E)-3-[4-[3-(2-ethylbenzoyl)-7-phenylmethoxyquinolin-4-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | CCc1ccccc1C(=O)c1cnc2cc(OCc3ccccc3)ccc2c1Oc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C34H27NO5/c1-2-25-10-6-7-11-28(25)33(38)30-21-35-31-20-27(39-22-24-8-4-3-5-9-24)17-18-29(31)34(30)40-26-15-12-23(13-16-26)14-19-32(36)37/h3-21H,2,22H2,1H3,(H,36,37)/b19-14+ |
| InChIKey | NMUYIUQPFXDNAR-XMHGGMMESA-N |
| XLogP | 7.50 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|