C25H17NO5 — CID 169092977
(E)-3-[4-(3-benzoyl-7-hydroxyquinolin-4-yl)oxyphenyl]prop-2-enoic acid (PubChem CID 169092977) has the molecular formula C25H17NO5 and a molecular weight of 411.41 g/mol. Its IUPAC name is (E)-3-[4-(3-benzoyl-7-hydroxyquinolin-4-yl)oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(3-benzoyl-7-hydroxyquinolin-4-yl)oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 169092977 |
| Molecular Formula | C25H17NO5 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (E)-3-[4-(3-benzoyl-7-hydroxyquinolin-4-yl)oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Oc2c(C(=O)c3ccccc3)cnc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C25H17NO5/c27-18-9-12-20-22(14-18)26-15-21(24(30)17-4-2-1-3-5-17)25(20)31-19-10-6-16(7-11-19)8-13-23(28)29/h1-15,27H,(H,28,29)/b13-8+ |
| InChIKey | USVBEIQOQZNYMM-MDWZMJQESA-N |
| XLogP | 5.06 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|