C27H21NO6 — CID 169092981
(E)-3-[4-[7-hydroxy-3-(4-methoxybenzoyl)quinolin-4-yl]oxyphenyl]-2-methylprop-2-enoic acid (PubChem CID 169092981) has the molecular formula C27H21NO6 and a molecular weight of 455.47 g/mol. Its IUPAC name is (E)-3-[4-[7-hydroxy-3-(4-methoxybenzoyl)quinolin-4-yl]oxyphenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[7-hydroxy-3-(4-methoxybenzoyl)quinolin-4-yl]oxyphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 169092981 |
| Molecular Formula | C27H21NO6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (E)-3-[4-[7-hydroxy-3-(4-methoxybenzoyl)quinolin-4-yl]oxyphenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1ccc(C(=O)c2cnc3cc(O)ccc3c2Oc2ccc(/C=C(\C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H21NO6/c1-16(27(31)32)13-17-3-8-21(9-4-17)34-26-22-12-7-19(29)14-24(22)28-15-23(26)25(30)18-5-10-20(33-2)11-6-18/h3-15,29H,1-2H3,(H,31,32)/b16-13+ |
| InChIKey | VAAIEMJKRBLWRJ-DTQAZKPQSA-N |
| XLogP | 5.46 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|