C18H13BrO4S — CID 134279874
(E)-3-[4-[(2-bromo-6-hydroxy-1-benzothiophen-3-yl)oxy]phenyl]-2-methylprop-2-enoic acid (PubChem CID 134279874) has the molecular formula C18H13BrO4S and a molecular weight of 405.27 g/mol. Its IUPAC name is (E)-3-[4-[(2-bromo-6-hydroxy-1-benzothiophen-3-yl)oxy]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2-bromo-6-hydroxy-1-benzothiophen-3-yl)oxy]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 134279874 |
| Molecular Formula | C18H13BrO4S |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | (E)-3-[4-[(2-bromo-6-hydroxy-1-benzothiophen-3-yl)oxy]phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1ccc(Oc2c(Br)sc3cc(O)ccc23)cc1)C(=O)O |
| InChI | InChI=1S/C18H13BrO4S/c1-10(18(21)22)8-11-2-5-13(6-3-11)23-16-14-7-4-12(20)9-15(14)24-17(16)19/h2-9,20H,1H3,(H,21,22)/b10-8+ |
| InChIKey | PMJWZMKTZBIUHG-CSKARUKUSA-N |
| XLogP | 5.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|