C20H20O4 — CID 54324081
3-[4-(4-methoxy-2,5-dimethylbenzoyl)phenyl]-2-methylprop-2-enoic acid (PubChem CID 54324081) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[4-(4-methoxy-2,5-dimethylbenzoyl)phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-(4-methoxy-2,5-dimethylbenzoyl)phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 54324081 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-[4-(4-methoxy-2,5-dimethylbenzoyl)phenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1cc(C)c(C(=O)c2ccc(C=C(C)C(=O)O)cc2)cc1C |
| InChI | InChI=1S/C20H20O4/c1-12-11-18(24-4)13(2)10-17(12)19(21)16-7-5-15(6-8-16)9-14(3)20(22)23/h5-11H,1-4H3,(H,22,23) |
| InChIKey | STRHPBAMLOMJRK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|