C41H53N7O9 — CID 175449669
(3S)-3-acetamido-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid;4-[(4-methyl-2-pyridinyl)amino]butanamide (PubChem CID 175449669) has the molecular formula C41H53N7O9 and a molecular weight of 787.91 g/mol. Its IUPAC name is (3S)-3-acetamido-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid;4-[(4-methyl-2-pyridinyl)amino]butanamide.
| Compound Name | (3S)-3-acetamido-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid;4-[(4-methyl-2-pyridinyl)amino]butanamide |
|---|---|
| PubChem CID | 175449669 |
| Molecular Formula | C41H53N7O9 |
| Molecular Weight | 787.91 g/mol |
| Exact Mass | 787.39 |
| IUPAC Name | (3S)-3-acetamido-3-[4-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]naphthalen-1-yl]phenyl]propanoic acid;4-[(4-methyl-2-pyridinyl)amino]butanamide |
| SMILES | CC(=O)N[C@@H](CC(=O)O)c1ccc(-c2ccc(OCCOCCOCCOCCOCCN=[N+]=[N-])c3ccccc23)cc1.Cc1ccnc(NCCCC(N)=O)c1 |
| InChI | InChI=1S/C31H38N4O8.C10H15N3O/c1-23(36)34-29(22-31(37)38)25-8-6-24(7-9-25)26-10-11-30(28-5-3-2-4-27(26)28)43-21-20-42-19-18-41-17-16-40-15-14-39-13-12-33-35-32;1-8-4-6-13-10(7-8)12-5-2-3-9(11)14/h2-11,29H,12-22H2,1H3,(H,34,36)(H,37,38);4,6-7H,2-3,5H2,1H3,(H2,11,14)(H,12,13)/t29-;/m0./s1 |
| InChIKey | CNUKYBNKBLCPGZ-JMAPEOGHSA-N |
| XLogP | 5.98 |
| TPSA | 229.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.91 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|