About 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid
4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid (PubChem CID 175454334) has the molecular formula C16H26N4O3S
and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid |
| PubChem CID | 175454334 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid |
| SMILES | CC(=O)Nc1ncc(CN2CCN(C(=O)O)C(C(C)(C)C)C2C)s1 |
| InChI | InChI=1S/C16H26N4O3S/c1-10-13(16(3,4)5)20(15(22)23)7-6-19(10)9-12-8-17-14(24-12)18-11(2)21/h8,10,13H,6-7,9H2,1-5H3,(H,22,23)(H,17,18,21) |
| InChIKey | DDQUNDGTSWSMMN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid?
The IUPAC name of 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid (CID 175454334) is 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid.
What is the SMILES notation for 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid?
The canonical SMILES for 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid is CC(=O)Nc1ncc(CN2CCN(C(=O)O)C(C(C)(C)C)C2C)s1.
What is the InChIKey of 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid?
The InChIKey is DDQUNDGTSWSMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O3S/c1-10-13(16(3,4)5)20(15(22)23)7-6-19(10)9-12-8-17-14(24-12)18-11(2)21/h8,10,13H,6-7,9H2,1-5H3,(H,22,23)(H,17,18,21).
What are the key properties of 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid?
4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid has a molecular weight of 354.48 g/mol, XLogP of 2.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-acetamido-1,3-thiazol-5-yl)methyl]-2-tert-butyl-3-methylpiperazine-1-carboxylic acid is sourced from PubChem (CID 175454334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).