About indeno[2,1-d]pyrimidin-4-one
indeno[2,1-d]pyrimidin-4-one (PubChem CID 175454568) has the molecular formula C11H6N2O
and a molecular weight of 182.18 g/mol. Its IUPAC name is indeno[2,1-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | indeno[2,1-d]pyrimidin-4-one |
| PubChem CID | 175454568 |
| Molecular Formula | C11H6N2O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | indeno[2,1-d]pyrimidin-4-one |
| SMILES | O=C1N=CN=C2C=c3ccccc3=C12 |
| InChI | InChI=1S/C11H6N2O/c14-11-10-8-4-2-1-3-7(8)5-9(10)12-6-13-11/h1-6H |
| InChIKey | WAMGWLMTRMBKND-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indeno[2,1-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[2,1-d]pyrimidin-4-one?
The IUPAC name of indeno[2,1-d]pyrimidin-4-one (CID 175454568) is indeno[2,1-d]pyrimidin-4-one.
What is the SMILES notation for indeno[2,1-d]pyrimidin-4-one?
The canonical SMILES for indeno[2,1-d]pyrimidin-4-one is O=C1N=CN=C2C=c3ccccc3=C12.
What is the InChIKey of indeno[2,1-d]pyrimidin-4-one?
The InChIKey is WAMGWLMTRMBKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O/c14-11-10-8-4-2-1-3-7(8)5-9(10)12-6-13-11/h1-6H.
What are the key properties of indeno[2,1-d]pyrimidin-4-one?
indeno[2,1-d]pyrimidin-4-one has a molecular weight of 182.18 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[2,1-d]pyrimidin-4-one is sourced from PubChem (CID 175454568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).