About imidazo[4,5-h]isoquinolin-9-one
imidazo[4,5-h]isoquinolin-9-one (PubChem CID 90904928) has the molecular formula C10H5N3O
and a molecular weight of 183.17 g/mol. Its IUPAC name is imidazo[4,5-h]isoquinolin-9-one.
Molecular Properties
| Compound Name | imidazo[4,5-h]isoquinolin-9-one |
| PubChem CID | 90904928 |
| Molecular Formula | C10H5N3O |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | imidazo[4,5-h]isoquinolin-9-one |
| SMILES | O=C1N=CC=c2ccc3c(c21)N=CN=3 |
| InChI | InChI=1S/C10H5N3O/c14-10-8-6(3-4-11-10)1-2-7-9(8)13-5-12-7/h1-5H |
| InChIKey | QQTAJIAHTYPYLE-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[4,5-h]isoquinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-h]isoquinolin-9-one?
The IUPAC name of imidazo[4,5-h]isoquinolin-9-one (CID 90904928) is imidazo[4,5-h]isoquinolin-9-one.
What is the SMILES notation for imidazo[4,5-h]isoquinolin-9-one?
The canonical SMILES for imidazo[4,5-h]isoquinolin-9-one is O=C1N=CC=c2ccc3c(c21)N=CN=3.
What is the InChIKey of imidazo[4,5-h]isoquinolin-9-one?
The InChIKey is QQTAJIAHTYPYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3O/c14-10-8-6(3-4-11-10)1-2-7-9(8)13-5-12-7/h1-5H.
What are the key properties of imidazo[4,5-h]isoquinolin-9-one?
imidazo[4,5-h]isoquinolin-9-one has a molecular weight of 183.17 g/mol, XLogP of -0.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-h]isoquinolin-9-one is sourced from PubChem (CID 90904928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).