C11H6N2O — CID 19874670
4,10-diazatricyclo[7.4.0.02,7]trideca-1,4,6,8,10,12-hexaen-3-one (PubChem CID 19874670) has the molecular formula C11H6N2O and a molecular weight of 182.18 g/mol. Its IUPAC name is 4,10-diazatricyclo[7.4.0.02,7]trideca-1,4,6,8,10,12-hexaen-3-one.
| Compound Name | 4,10-diazatricyclo[7.4.0.02,7]trideca-1,4,6,8,10,12-hexaen-3-one |
|---|---|
| PubChem CID | 19874670 |
| Molecular Formula | C11H6N2O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4,10-diazatricyclo[7.4.0.02,7]trideca-1,4,6,8,10,12-hexaen-3-one |
| SMILES | O=C1N=CC=C2C=c3ncccc3=C12 |
| InChI | InChI=1S/C11H6N2O/c14-11-10-7(3-5-13-11)6-9-8(10)2-1-4-12-9/h1-6H |
| InChIKey | JJLJCNFQCYAUHG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |