C26H37F2N5O5 — CID 175454702
4-(3,4-difluorophenyl)-2-[[1-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl]triazole-4-carbonyl]amino]butanoic acid (PubChem CID 175454702) has the molecular formula C26H37F2N5O5 and a molecular weight of 537.61 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-[[1-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl]triazole-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-(3,4-difluorophenyl)-2-[[1-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl]triazole-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175454702 |
| Molecular Formula | C26H37F2N5O5 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-[[1-[8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl]triazole-4-carbonyl]amino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCn1cc(C(=O)NC(CCc2ccc(F)c(F)c2)C(=O)O)nn1 |
| InChI | InChI=1S/C26H37F2N5O5/c1-26(2,3)38-25(37)29-14-8-6-4-5-7-9-15-33-17-22(31-32-33)23(34)30-21(24(35)36)13-11-18-10-12-19(27)20(28)16-18/h10,12,16-17,21H,4-9,11,13-15H2,1-3H3,(H,29,37)(H,30,34)(H,35,36) |
| InChIKey | IVLWJNNPMPQJDY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|