About isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one
isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one (PubChem CID 175457296) has the molecular formula C13H14N2O3
and a molecular weight of 246.27 g/mol. Its IUPAC name is isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one |
| PubChem CID | 175457296 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1ccccc1C.N=C=O.N=C=O |
| InChI | InChI=1S/C11H12O.2CHNO/c1-8(2)11(12)10-7-5-4-6-9(10)3;2*2-1-3/h4-7H,1H2,2-3H3;2*2H |
| InChIKey | JBXYSHDJLHRFBO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one?
The IUPAC name of isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one (CID 175457296) is isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one.
What is the SMILES notation for isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one?
The canonical SMILES for isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one is C=C(C)C(=O)c1ccccc1C.N=C=O.N=C=O.
What is the InChIKey of isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one?
The InChIKey is JBXYSHDJLHRFBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O.2CHNO/c1-8(2)11(12)10-7-5-4-6-9(10)3;2*2-1-3/h4-7H,1H2,2-3H3;2*2H.
What are the key properties of isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one?
isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one has a molecular weight of 246.27 g/mol, XLogP of 2.56, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;2-methyl-1-(2-methylphenyl)prop-2-en-1-one is sourced from PubChem (CID 175457296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).