C19H32FN3O6 — CID 175458576
2-[amino-[4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]pentanoyl]amino]-3-(2-oxopiperidin-3-yl)propanoic acid (PubChem CID 175458576) has the molecular formula C19H32FN3O6 and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[amino-[4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]pentanoyl]amino]-3-(2-oxopiperidin-3-yl)propanoic acid.
| Compound Name | 2-[amino-[4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]pentanoyl]amino]-3-(2-oxopiperidin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 175458576 |
| Molecular Formula | C19H32FN3O6 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2-[amino-[4-fluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]pentanoyl]amino]-3-(2-oxopiperidin-3-yl)propanoic acid |
| SMILES | CC(C)(F)CC(C(=O)OC(C)(C)C)C(=O)N(N)C(CC1CCCNC1=O)C(=O)O |
| InChI | InChI=1S/C19H32FN3O6/c1-18(2,3)29-17(28)12(10-19(4,5)20)15(25)23(21)13(16(26)27)9-11-7-6-8-22-14(11)24/h11-13H,6-10,21H2,1-5H3,(H,22,24)(H,26,27) |
| InChIKey | RNQBUEJYZLNOSU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|