C22H23NO3S2 — CID 175459395
4-morpholin-4-ylsulfonyl-1,6-diphenylcyclohexa-2,4-diene-1-thiol (PubChem CID 175459395) has the molecular formula C22H23NO3S2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-1,6-diphenylcyclohexa-2,4-diene-1-thiol.
| Compound Name | 4-morpholin-4-ylsulfonyl-1,6-diphenylcyclohexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 175459395 |
| Molecular Formula | C22H23NO3S2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-1,6-diphenylcyclohexa-2,4-diene-1-thiol |
| SMILES | O=S(=O)(C1=CC(c2ccccc2)C(S)(c2ccccc2)C=C1)N1CCOCC1 |
| InChI | InChI=1S/C22H23NO3S2/c24-28(25,23-13-15-26-16-14-23)20-11-12-22(27,19-9-5-2-6-10-19)21(17-20)18-7-3-1-4-8-18/h1-12,17,21,27H,13-16H2 |
| InChIKey | JRBLKEMVZGFUMP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|