C15H28N4O3 — CID 175463060
3,3-dimorpholin-4-yl-1-piperazin-1-ylpropan-1-one (PubChem CID 175463060) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3,3-dimorpholin-4-yl-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3,3-dimorpholin-4-yl-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 175463060 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 3,3-dimorpholin-4-yl-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(CC(N1CCOCC1)N1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C15H28N4O3/c20-15(19-3-1-16-2-4-19)13-14(17-5-9-21-10-6-17)18-7-11-22-12-8-18/h14,16H,1-13H2 |
| InChIKey | HACVLFXVQJTBGN-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |