C16H24FNO9S — CID 175463137
2,3-dihydroxybutanedioic acid;N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine (PubChem CID 175463137) has the molecular formula C16H24FNO9S and a molecular weight of 425.43 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine.
| Compound Name | 2,3-dihydroxybutanedioic acid;N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 175463137 |
| Molecular Formula | C16H24FNO9S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;N-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]propan-1-amine |
| SMILES | CCCNCCOc1cc(F)cc(S(C)(=O)=O)c1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H18FNO3S.C4H6O6/c1-3-4-14-5-6-17-11-7-10(13)8-12(9-11)18(2,15)16;5-1(3(7)8)2(6)4(9)10/h7-9,14H,3-6H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | RVVLSGZJNROIAK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|