C13H13FO7S — CID 175463139
(Z)-2-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]but-2-enedioic acid (PubChem CID 175463139) has the molecular formula C13H13FO7S and a molecular weight of 332.31 g/mol. Its IUPAC name is (Z)-2-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]but-2-enedioic acid.
| Compound Name | (Z)-2-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 175463139 |
| Molecular Formula | C13H13FO7S |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (Z)-2-[2-(3-fluoro-5-methylsulfonylphenoxy)ethyl]but-2-enedioic acid |
| SMILES | CS(=O)(=O)c1cc(F)cc(OCC/C(=C/C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C13H13FO7S/c1-22(19,20)11-6-9(14)5-10(7-11)21-3-2-8(13(17)18)4-12(15)16/h4-7H,2-3H2,1H3,(H,15,16)(H,17,18)/b8-4- |
| InChIKey | PWLSFJYDSDHFEL-YWEYNIOJSA-N |
| XLogP | 1.09 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|