C16H13Cl2NO3 — CID 175467717
N-(3,4-dichlorophenyl)-2-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 175467717) has the molecular formula C16H13Cl2NO3 and a molecular weight of 338.19 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 175467717 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | C=C(C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C16H13Cl2NO3/c1-9(10-3-6-14(20)15(7-10)22-2)16(21)19-11-4-5-12(17)13(18)8-11/h3-8,20H,1H2,2H3,(H,19,21) |
| InChIKey | JHAKWWSEIXHVAZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|