C17H24F2N2O3 — CID 175468401
tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate (PubChem CID 175468401) has the molecular formula C17H24F2N2O3 and a molecular weight of 342.39 g/mol. Its IUPAC name is tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 175468401 |
| Molecular Formula | C17H24F2N2O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate |
| SMILES | COc1ccc(C2(C)C(F)NCC(F)C2C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C17H24F2N2O3/c1-16(2,3)24-14(22)13-11(18)9-21-15(19)17(13,4)10-6-7-12(23-5)20-8-10/h6-8,11,13,15,21H,9H2,1-5H3 |
| InChIKey | ONOKUVPAMJIZRB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|