About tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate
tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate (PubChem CID 175468401) has the molecular formula C17H24F2N2O3
and a molecular weight of 342.39 g/mol. Its IUPAC name is tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate |
| PubChem CID | 175468401 |
| Molecular Formula | C17H24F2N2O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate |
| SMILES | COc1ccc(C2(C)C(F)NCC(F)C2C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C17H24F2N2O3/c1-16(2,3)24-14(22)13-11(18)9-21-15(19)17(13,4)10-6-7-12(23-5)20-8-10/h6-8,11,13,15,21H,9H2,1-5H3 |
| InChIKey | ONOKUVPAMJIZRB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate?
The IUPAC name of tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate (CID 175468401) is tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate.
What is the SMILES notation for tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate?
The canonical SMILES for tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate is COc1ccc(C2(C)C(F)NCC(F)C2C(=O)OC(C)(C)C)cn1.
What is the InChIKey of tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate?
The InChIKey is ONOKUVPAMJIZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N2O3/c1-16(2,3)24-14(22)13-11(18)9-21-15(19)17(13,4)10-6-7-12(23-5)20-8-10/h6-8,11,13,15,21H,9H2,1-5H3.
What are the key properties of tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate?
tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate has a molecular weight of 342.39 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,5-difluoro-3-(6-methoxy-3-pyridinyl)-3-methylpiperidine-4-carboxylate is sourced from PubChem (CID 175468401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).