C14H19N5O3 — CID 151999658
tert-butyl 3-azido-3-(6-methoxy-3-pyridinyl)azetidine-1-carboxylate (PubChem CID 151999658) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is tert-butyl 3-azido-3-(6-methoxy-3-pyridinyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-azido-3-(6-methoxy-3-pyridinyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 151999658 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | tert-butyl 3-azido-3-(6-methoxy-3-pyridinyl)azetidine-1-carboxylate |
| SMILES | COc1ccc(C2(N=[N+]=[N-])CN(C(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C14H19N5O3/c1-13(2,3)22-12(20)19-8-14(9-19,17-18-15)10-5-6-11(21-4)16-7-10/h5-7H,8-9H2,1-4H3 |
| InChIKey | UGKKGRXWWLDBFU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|